C13H17N3O5 — CID 8986851
[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 2-(2-oxo-1-pyridinyl)acetate (PubChem CID 8986851) has the molecular formula C13H17N3O5 and a molecular weight of 295.30 g/mol. Its IUPAC name is [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 2-(2-oxo-1-pyridinyl)acetate.
| Compound Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 2-(2-oxo-1-pyridinyl)acetate |
|---|---|
| PubChem CID | 8986851 |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 2-(2-oxo-1-pyridinyl)acetate |
| SMILES | CC(C)NC(=O)NC(=O)COC(=O)Cn1ccccc1=O |
| InChI | InChI=1S/C13H17N3O5/c1-9(2)14-13(20)15-10(17)8-21-12(19)7-16-6-4-3-5-11(16)18/h3-6,9H,7-8H2,1-2H3,(H2,14,15,17,20) |
| InChIKey | QCYOXBKUIRJWRK-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |