C20H23N3O4S — CID 8987246
[(2S)-1-[2-cyanoethyl(methyl)amino]-1-oxopropan-2-yl] (3R,7aR)-5-oxo-7a-phenyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 8987246) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is [(2S)-1-[2-cyanoethyl(methyl)amino]-1-oxopropan-2-yl] (3R,7aR)-5-oxo-7a-phenyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | [(2S)-1-[2-cyanoethyl(methyl)amino]-1-oxopropan-2-yl] (3R,7aR)-5-oxo-7a-phenyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 8987246 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | [(2S)-1-[2-cyanoethyl(methyl)amino]-1-oxopropan-2-yl] (3R,7aR)-5-oxo-7a-phenyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | C[C@H](OC(=O)[C@@H]1CS[C@@]2(c3ccccc3)CCC(=O)N12)C(=O)N(C)CCC#N |
| InChI | InChI=1S/C20H23N3O4S/c1-14(18(25)22(2)12-6-11-21)27-19(26)16-13-28-20(10-9-17(24)23(16)20)15-7-4-3-5-8-15/h3-5,7-8,14,16H,6,9-10,12-13H2,1-2H3/t14-,16-,20+/m0/s1 |
| InChIKey | XQNWTKPPTOUFAV-DKICVRJWSA-N |
| XLogP | 1.88 |
| TPSA | 90.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |