About [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] 2-bromo-5-fluorobenzoate
[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] 2-bromo-5-fluorobenzoate (PubChem CID 8987566) has the molecular formula C12H9BrFNO5
and a molecular weight of 346.11 g/mol. Its IUPAC name is [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] 2-bromo-5-fluorobenzoate.
Molecular Properties
| Compound Name | [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] 2-bromo-5-fluorobenzoate |
| PubChem CID | 8987566 |
| Molecular Formula | C12H9BrFNO5 |
| Molecular Weight | 346.11 g/mol |
| Exact Mass | 344.96 |
| IUPAC Name | [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] 2-bromo-5-fluorobenzoate |
| SMILES | O=C(OCC(=O)N1CCOC1=O)c1cc(F)ccc1Br |
| InChI | InChI=1S/C12H9BrFNO5/c13-9-2-1-7(14)5-8(9)11(17)20-6-10(16)15-3-4-19-12(15)18/h1-2,5H,3-4,6H2 |
| InChIKey | ZDBNWLLYPMXDQH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.11 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] 2-bromo-5-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] 2-bromo-5-fluorobenzoate?
The IUPAC name of [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] 2-bromo-5-fluorobenzoate (CID 8987566) is [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] 2-bromo-5-fluorobenzoate.
What is the SMILES notation for [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] 2-bromo-5-fluorobenzoate?
The canonical SMILES for [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] 2-bromo-5-fluorobenzoate is O=C(OCC(=O)N1CCOC1=O)c1cc(F)ccc1Br.
What is the InChIKey of [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] 2-bromo-5-fluorobenzoate?
The InChIKey is ZDBNWLLYPMXDQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9BrFNO5/c13-9-2-1-7(14)5-8(9)11(17)20-6-10(16)15-3-4-19-12(15)18/h1-2,5H,3-4,6H2.
What are the key properties of [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] 2-bromo-5-fluorobenzoate?
[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] 2-bromo-5-fluorobenzoate has a molecular weight of 346.11 g/mol, XLogP of 1.72, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] 2-bromo-5-fluorobenzoate is sourced from PubChem (CID 8987566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).