C19H17ClN3O5- — CID 8989656
2-[4-chloro-2-[(Z)-[[2-(2,6-dimethylanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 8989656) has the molecular formula C19H17ClN3O5- and a molecular weight of 402.81 g/mol. Its IUPAC name is 2-[4-chloro-2-[(Z)-[[2-(2,6-dimethylanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | 2-[4-chloro-2-[(Z)-[[2-(2,6-dimethylanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 8989656 |
| Molecular Formula | C19H17ClN3O5- |
| Molecular Weight | 402.81 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 2-[4-chloro-2-[(Z)-[[2-(2,6-dimethylanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | Cc1cccc(C)c1NC(=O)C(=O)N/N=C\c1cc(Cl)ccc1OCC(=O)[O-] |
| InChI | InChI=1S/C19H18ClN3O5/c1-11-4-3-5-12(2)17(11)22-18(26)19(27)23-21-9-13-8-14(20)6-7-15(13)28-10-16(24)25/h3-9H,10H2,1-2H3,(H,22,26)(H,23,27)(H,24,25)/p-1/b21-9- |
| InChIKey | BYMWHSIWGDCOCH-NKVSQWTQSA-M |
| XLogP | 1.17 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.81 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|