C19H19ClN4O4 — CID 8990173
N'-[(Z)-[2-(2-amino-2-oxoethoxy)-5-chlorophenyl]methylideneamino]-N-(3,4-dimethylphenyl)oxamide (PubChem CID 8990173) has the molecular formula C19H19ClN4O4 and a molecular weight of 402.84 g/mol. Its IUPAC name is N'-[(Z)-[2-(2-amino-2-oxoethoxy)-5-chlorophenyl]methylideneamino]-N-(3,4-dimethylphenyl)oxamide.
| Compound Name | N'-[(Z)-[2-(2-amino-2-oxoethoxy)-5-chlorophenyl]methylideneamino]-N-(3,4-dimethylphenyl)oxamide |
|---|---|
| PubChem CID | 8990173 |
| Molecular Formula | C19H19ClN4O4 |
| Molecular Weight | 402.84 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | N'-[(Z)-[2-(2-amino-2-oxoethoxy)-5-chlorophenyl]methylideneamino]-N-(3,4-dimethylphenyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)N/N=C\c2cc(Cl)ccc2OCC(N)=O)cc1C |
| InChI | InChI=1S/C19H19ClN4O4/c1-11-3-5-15(7-12(11)2)23-18(26)19(27)24-22-9-13-8-14(20)4-6-16(13)28-10-17(21)25/h3-9H,10H2,1-2H3,(H2,21,25)(H,23,26)(H,24,27)/b22-9- |
| InChIKey | HFLJHVGPZZYROU-AFPJDJCSSA-N |
| XLogP | 1.91 |
| TPSA | 122.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.84 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|