C18H15ClN3O5- — CID 8989436
4-[[4-chloro-2-[(Z)-[[2-(methylamino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]methyl]benzoate (PubChem CID 8989436) has the molecular formula C18H15ClN3O5- and a molecular weight of 388.79 g/mol. Its IUPAC name is 4-[[4-chloro-2-[(Z)-[[2-(methylamino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]methyl]benzoate.
| Compound Name | 4-[[4-chloro-2-[(Z)-[[2-(methylamino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 8989436 |
| Molecular Formula | C18H15ClN3O5- |
| Molecular Weight | 388.79 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 4-[[4-chloro-2-[(Z)-[[2-(methylamino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]methyl]benzoate |
| SMILES | CNC(=O)C(=O)N/N=C\c1cc(Cl)ccc1OCc1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C18H16ClN3O5/c1-20-16(23)17(24)22-21-9-13-8-14(19)6-7-15(13)27-10-11-2-4-12(5-3-11)18(25)26/h2-9H,10H2,1H3,(H,20,23)(H,22,24)(H,25,26)/p-1/b21-9- |
| InChIKey | RTRLIBMBUCNQJU-NKVSQWTQSA-M |
| XLogP | 0.48 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.79 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|