C15H11NO3S — CID 8991295
(4R)-4-phenyl-1-(thiophene-2-carbonyl)pyrrolidine-2,3-dione (PubChem CID 8991295) has the molecular formula C15H11NO3S and a molecular weight of 285.32 g/mol. Its IUPAC name is (4R)-4-phenyl-1-(thiophene-2-carbonyl)pyrrolidine-2,3-dione.
| Compound Name | (4R)-4-phenyl-1-(thiophene-2-carbonyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 8991295 |
| Molecular Formula | C15H11NO3S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | (4R)-4-phenyl-1-(thiophene-2-carbonyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(C(=O)c2cccs2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C15H11NO3S/c17-13-11(10-5-2-1-3-6-10)9-16(15(13)19)14(18)12-7-4-8-20-12/h1-8,11H,9H2/t11-/m0/s1 |
| InChIKey | YVFNYHJDNVVPIF-NSHDSACASA-N |
| XLogP | 2.08 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|