C22H30N3O4+ — CID 8992376
[(1R)-1-(4-ethylphenyl)-2-methylpropyl]-[(2R)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl]azanium (PubChem CID 8992376) has the molecular formula C22H30N3O4+ and a molecular weight of 400.50 g/mol. Its IUPAC name is [(1R)-1-(4-ethylphenyl)-2-methylpropyl]-[(2R)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl]azanium.
| Compound Name | [(1R)-1-(4-ethylphenyl)-2-methylpropyl]-[(2R)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl]azanium |
|---|---|
| PubChem CID | 8992376 |
| Molecular Formula | C22H30N3O4+ |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | [(1R)-1-(4-ethylphenyl)-2-methylpropyl]-[(2R)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl]azanium |
| SMILES | CCc1ccc([C@H]([NH2+][C@H](C)C(=O)Nc2ccc([N+](=O)[O-])cc2OC)C(C)C)cc1 |
| InChI | InChI=1S/C22H29N3O4/c1-6-16-7-9-17(10-8-16)21(14(2)3)23-15(4)22(26)24-19-12-11-18(25(27)28)13-20(19)29-5/h7-15,21,23H,6H2,1-5H3,(H,24,26)/p+1/t15-,21-/m1/s1 |
| InChIKey | QMRDWGYTPHJLNE-QVKFZJNVSA-O |
| XLogP | 3.45 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|