C23H18FNO5 — CID 8995399
[2-oxo-2-[3-(2-oxopyrrolidin-1-yl)phenyl]ethyl] 5-(4-fluorophenyl)furan-2-carboxylate (PubChem CID 8995399) has the molecular formula C23H18FNO5 and a molecular weight of 407.40 g/mol. Its IUPAC name is [2-oxo-2-[3-(2-oxopyrrolidin-1-yl)phenyl]ethyl] 5-(4-fluorophenyl)furan-2-carboxylate.
| Compound Name | [2-oxo-2-[3-(2-oxopyrrolidin-1-yl)phenyl]ethyl] 5-(4-fluorophenyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 8995399 |
| Molecular Formula | C23H18FNO5 |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | [2-oxo-2-[3-(2-oxopyrrolidin-1-yl)phenyl]ethyl] 5-(4-fluorophenyl)furan-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc(-c2ccc(F)cc2)o1)c1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C23H18FNO5/c24-17-8-6-15(7-9-17)20-10-11-21(30-20)23(28)29-14-19(26)16-3-1-4-18(13-16)25-12-2-5-22(25)27/h1,3-4,6-11,13H,2,5,12,14H2 |
| InChIKey | VBJYOENWOXMUBZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |