C21H37N3O3+2 — CID 8997911
2-[4-[(2-methoxy-5-methylphenyl)methyl]piperazine-1,4-diium-1-yl]-N-(3-propan-2-yloxypropyl)acetamide (PubChem CID 8997911) has the molecular formula C21H37N3O3+2 and a molecular weight of 379.55 g/mol. Its IUPAC name is 2-[4-[(2-methoxy-5-methylphenyl)methyl]piperazine-1,4-diium-1-yl]-N-(3-propan-2-yloxypropyl)acetamide.
| Compound Name | 2-[4-[(2-methoxy-5-methylphenyl)methyl]piperazine-1,4-diium-1-yl]-N-(3-propan-2-yloxypropyl)acetamide |
|---|---|
| PubChem CID | 8997911 |
| Molecular Formula | C21H37N3O3+2 |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.28 |
| IUPAC Name | 2-[4-[(2-methoxy-5-methylphenyl)methyl]piperazine-1,4-diium-1-yl]-N-(3-propan-2-yloxypropyl)acetamide |
| SMILES | COc1ccc(C)cc1C[NH+]1CC[NH+](CC(=O)NCCCOC(C)C)CC1 |
| InChI | InChI=1S/C21H35N3O3/c1-17(2)27-13-5-8-22-21(25)16-24-11-9-23(10-12-24)15-19-14-18(3)6-7-20(19)26-4/h6-7,14,17H,5,8-13,15-16H2,1-4H3,(H,22,25)/p+2 |
| InChIKey | KFPMLKYFNLCLPO-UHFFFAOYSA-P |
| XLogP | -0.78 |
| TPSA | 56.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|