C10H14BrN3O2S — CID 90001474
5-bromo-4-methyl-2-(3-methylsulfonylpyrrolidin-1-yl)pyrimidine (PubChem CID 90001474) has the molecular formula C10H14BrN3O2S and a molecular weight of 320.21 g/mol. Its IUPAC name is 5-bromo-4-methyl-2-(3-methylsulfonylpyrrolidin-1-yl)pyrimidine.
| Compound Name | 5-bromo-4-methyl-2-(3-methylsulfonylpyrrolidin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 90001474 |
| Molecular Formula | C10H14BrN3O2S |
| Molecular Weight | 320.21 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | 5-bromo-4-methyl-2-(3-methylsulfonylpyrrolidin-1-yl)pyrimidine |
| SMILES | Cc1nc(N2CCC(S(C)(=O)=O)C2)ncc1Br |
| InChI | InChI=1S/C10H14BrN3O2S/c1-7-9(11)5-12-10(13-7)14-4-3-8(6-14)17(2,15)16/h5,8H,3-4,6H2,1-2H3 |
| InChIKey | MGNKHLNAUDGVMO-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.21 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |