C9H15N5O2S — CID 82380471
2-(3-aminopyrrolidin-1-yl)-5-methylsulfonylpyrimidin-4-amine (PubChem CID 82380471) has the molecular formula C9H15N5O2S and a molecular weight of 257.32 g/mol. Its IUPAC name is 2-(3-aminopyrrolidin-1-yl)-5-methylsulfonylpyrimidin-4-amine.
| Compound Name | 2-(3-aminopyrrolidin-1-yl)-5-methylsulfonylpyrimidin-4-amine |
|---|---|
| PubChem CID | 82380471 |
| Molecular Formula | C9H15N5O2S |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 2-(3-aminopyrrolidin-1-yl)-5-methylsulfonylpyrimidin-4-amine |
| SMILES | CS(=O)(=O)c1cnc(N2CCC(N)C2)nc1N |
| InChI | InChI=1S/C9H15N5O2S/c1-17(15,16)7-4-12-9(13-8(7)11)14-3-2-6(10)5-14/h4,6H,2-3,5,10H2,1H3,(H2,11,12,13) |
| InChIKey | UJYMVTJBUJRBQG-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 115.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |