C9H14N4O2S — CID 82386822
5-methylsulfonyl-2-pyrrolidin-3-ylpyrimidin-4-amine (PubChem CID 82386822) has the molecular formula C9H14N4O2S and a molecular weight of 242.30 g/mol. Its IUPAC name is 5-methylsulfonyl-2-pyrrolidin-3-ylpyrimidin-4-amine.
| Compound Name | 5-methylsulfonyl-2-pyrrolidin-3-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 82386822 |
| Molecular Formula | C9H14N4O2S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 5-methylsulfonyl-2-pyrrolidin-3-ylpyrimidin-4-amine |
| SMILES | CS(=O)(=O)c1cnc(C2CCNC2)nc1N |
| InChI | InChI=1S/C9H14N4O2S/c1-16(14,15)7-5-12-9(13-8(7)10)6-2-3-11-4-6/h5-6,11H,2-4H2,1H3,(H2,10,12,13) |
| InChIKey | AKRCJNCNFPVMNC-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |