C9H15N3O2S — CID 92614938
(3S)-3-(4-methylsulfonyl-1H-pyrazol-5-yl)piperidine (PubChem CID 92614938) has the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. Its IUPAC name is (3S)-3-(4-methylsulfonyl-1H-pyrazol-5-yl)piperidine.
| Compound Name | (3S)-3-(4-methylsulfonyl-1H-pyrazol-5-yl)piperidine |
|---|---|
| PubChem CID | 92614938 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | (3S)-3-(4-methylsulfonyl-1H-pyrazol-5-yl)piperidine |
| SMILES | CS(=O)(=O)c1cn[nH]c1[C@H]1CCCNC1 |
| InChI | InChI=1S/C9H15N3O2S/c1-15(13,14)8-6-11-12-9(8)7-3-2-4-10-5-7/h6-7,10H,2-5H2,1H3,(H,11,12)/t7-/m0/s1 |
| InChIKey | ALXAFYVCKSKGSF-ZETCQYMHSA-N |
| XLogP | 0.28 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |