C21H20S — CID 90003095
2,3-dibenzyl-4-prop-2-enylthiophene (PubChem CID 90003095) has the molecular formula C21H20S and a molecular weight of 304.46 g/mol. Its IUPAC name is 2,3-dibenzyl-4-prop-2-enylthiophene.
| Compound Name | 2,3-dibenzyl-4-prop-2-enylthiophene |
|---|---|
| PubChem CID | 90003095 |
| Molecular Formula | C21H20S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 2,3-dibenzyl-4-prop-2-enylthiophene |
| SMILES | C=CCc1csc(Cc2ccccc2)c1Cc1ccccc1 |
| InChI | InChI=1S/C21H20S/c1-2-9-19-16-22-21(15-18-12-7-4-8-13-18)20(19)14-17-10-5-3-6-11-17/h2-8,10-13,16H,1,9,14-15H2 |
| InChIKey | REXSMOLABARKBV-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|