C21H27ClN2O3 — CID 90006320
tert-butyl 9-chloro-1-(2-cyclopent-2-en-1-ylacetyl)-3,5-dihydro-2H-1,4-benzodiazepine-4-carboxylate (PubChem CID 90006320) has the molecular formula C21H27ClN2O3 and a molecular weight of 390.91 g/mol. Its IUPAC name is tert-butyl 9-chloro-1-(2-cyclopent-2-en-1-ylacetyl)-3,5-dihydro-2H-1,4-benzodiazepine-4-carboxylate.
| Compound Name | tert-butyl 9-chloro-1-(2-cyclopent-2-en-1-ylacetyl)-3,5-dihydro-2H-1,4-benzodiazepine-4-carboxylate |
|---|---|
| PubChem CID | 90006320 |
| Molecular Formula | C21H27ClN2O3 |
| Molecular Weight | 390.91 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | tert-butyl 9-chloro-1-(2-cyclopent-2-en-1-ylacetyl)-3,5-dihydro-2H-1,4-benzodiazepine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)CC2C=CCC2)c2c(Cl)cccc2C1 |
| InChI | InChI=1S/C21H27ClN2O3/c1-21(2,3)27-20(26)23-11-12-24(18(25)13-15-7-4-5-8-15)19-16(14-23)9-6-10-17(19)22/h4,6-7,9-10,15H,5,8,11-14H2,1-3H3 |
| InChIKey | AEHQGLMPJUDTRH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.91 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|