C18H18ClN3O4 — CID 9000729
[(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 1-(4-chlorophenyl)-6-methyl-4-oxopyridazine-3-carboxylate (PubChem CID 9000729) has the molecular formula C18H18ClN3O4 and a molecular weight of 375.81 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 1-(4-chlorophenyl)-6-methyl-4-oxopyridazine-3-carboxylate.
| Compound Name | [(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 1-(4-chlorophenyl)-6-methyl-4-oxopyridazine-3-carboxylate |
|---|---|
| PubChem CID | 9000729 |
| Molecular Formula | C18H18ClN3O4 |
| Molecular Weight | 375.81 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | [(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 1-(4-chlorophenyl)-6-methyl-4-oxopyridazine-3-carboxylate |
| SMILES | C=CCNC(=O)[C@@H](C)OC(=O)c1nn(-c2ccc(Cl)cc2)c(C)cc1=O |
| InChI | InChI=1S/C18H18ClN3O4/c1-4-9-20-17(24)12(3)26-18(25)16-15(23)10-11(2)22(21-16)14-7-5-13(19)6-8-14/h4-8,10,12H,1,9H2,2-3H3,(H,20,24)/t12-/m1/s1 |
| InChIKey | YNJKGZMMGIQINA-GFCCVEGCSA-N |
| XLogP | 2.04 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.81 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|