C12H23N2P — CID 90010353
1,2-dipyrrolidin-1-ylbut-1-enylphosphane (PubChem CID 90010353) has the molecular formula C12H23N2P and a molecular weight of 226.30 g/mol. Its IUPAC name is 1,2-dipyrrolidin-1-ylbut-1-enylphosphane.
| Compound Name | 1,2-dipyrrolidin-1-ylbut-1-enylphosphane |
|---|---|
| PubChem CID | 90010353 |
| Molecular Formula | C12H23N2P |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 1,2-dipyrrolidin-1-ylbut-1-enylphosphane |
| SMILES | CCC(=C(P)N1CCCC1)N1CCCC1 |
| InChI | InChI=1S/C12H23N2P/c1-2-11(13-7-3-4-8-13)12(15)14-9-5-6-10-14/h2-10,15H2,1H3 |
| InChIKey | OBNSIUHMBPIGLL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|