C26H28N8O2 — CID 90014245
2-[[8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-2,6-dioxo-8H-purin-9-yl]methyl]quinoline-3-carbonitrile (PubChem CID 90014245) has the molecular formula C26H28N8O2 and a molecular weight of 484.56 g/mol. Its IUPAC name is 2-[[8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-2,6-dioxo-8H-purin-9-yl]methyl]quinoline-3-carbonitrile.
| Compound Name | 2-[[8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-2,6-dioxo-8H-purin-9-yl]methyl]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 90014245 |
| Molecular Formula | C26H28N8O2 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | 2-[[8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-2,6-dioxo-8H-purin-9-yl]methyl]quinoline-3-carbonitrile |
| SMILES | CC#CCN1c2c(n(C)c(=O)[nH]c2=O)N(Cc2nc3ccccc3cc2C#N)C1N1CCC[C@@H](N)C1 |
| InChI | InChI=1S/C26H28N8O2/c1-3-4-12-33-22-23(35)30-25(36)31(2)24(22)34(26(33)32-11-7-9-19(28)15-32)16-21-18(14-27)13-17-8-5-6-10-20(17)29-21/h5-6,8,10,13,19,26H,7,9,11-12,15-16,28H2,1-2H3,(H,30,35,36)/t19-,26?/m1/s1 |
| InChIKey | YGBYTXJOADAYBK-ICCFGIFFSA-N |
| XLogP | 1.05 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|