C15H22N6O2 — CID 174708378
(8R)-8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-9-methyl-3,8-dihydropurine-2,6-dione (PubChem CID 174708378) has the molecular formula C15H22N6O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is (8R)-8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-9-methyl-3,8-dihydropurine-2,6-dione.
| Compound Name | (8R)-8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-9-methyl-3,8-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 174708378 |
| Molecular Formula | C15H22N6O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (8R)-8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-9-methyl-3,8-dihydropurine-2,6-dione |
| SMILES | CC#CCN1c2c([nH]c(=O)[nH]c2=O)N(C)[C@@H]1N1CCC[C@@H](N)C1 |
| InChI | InChI=1S/C15H22N6O2/c1-3-4-8-21-11-12(17-14(23)18-13(11)22)19(2)15(21)20-7-5-6-10(16)9-20/h10,15H,5-9,16H2,1-2H3,(H2,17,18,22,23)/t10-,15-/m1/s1 |
| InChIKey | OLJUPXNXLZPAGG-MEBBXXQBSA-N |
| XLogP | -0.95 |
| TPSA | 101.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|