C15H19ClN6O — CID 23085286
6-(3-aminopiperidin-1-yl)-7-but-2-ynyl-2-chloro-9-methylpurin-8-one (PubChem CID 23085286) has the molecular formula C15H19ClN6O and a molecular weight of 334.81 g/mol. Its IUPAC name is 6-(3-aminopiperidin-1-yl)-7-but-2-ynyl-2-chloro-9-methylpurin-8-one.
| Compound Name | 6-(3-aminopiperidin-1-yl)-7-but-2-ynyl-2-chloro-9-methylpurin-8-one |
|---|---|
| PubChem CID | 23085286 |
| Molecular Formula | C15H19ClN6O |
| Molecular Weight | 334.81 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 6-(3-aminopiperidin-1-yl)-7-but-2-ynyl-2-chloro-9-methylpurin-8-one |
| SMILES | CC#CCn1c(=O)n(C)c2nc(Cl)nc(N3CCCC(N)C3)c21 |
| InChI | InChI=1S/C15H19ClN6O/c1-3-4-8-22-11-12(20(2)15(22)23)18-14(16)19-13(11)21-7-5-6-10(17)9-21/h10H,5-9,17H2,1-2H3 |
| InChIKey | OUGRSLRIHRIWEI-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 81.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.81 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|