C17H20ClF3N6O3 — CID 86605134
6-(3-aminopiperidin-1-yl)-7-but-2-ynyl-2-chloro-9-methylpurin-8-one;2,2,2-trifluoroacetic acid (PubChem CID 86605134) has the molecular formula C17H20ClF3N6O3 and a molecular weight of 448.83 g/mol. Its IUPAC name is 6-(3-aminopiperidin-1-yl)-7-but-2-ynyl-2-chloro-9-methylpurin-8-one;2,2,2-trifluoroacetic acid.
| Compound Name | 6-(3-aminopiperidin-1-yl)-7-but-2-ynyl-2-chloro-9-methylpurin-8-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 86605134 |
| Molecular Formula | C17H20ClF3N6O3 |
| Molecular Weight | 448.83 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 6-(3-aminopiperidin-1-yl)-7-but-2-ynyl-2-chloro-9-methylpurin-8-one;2,2,2-trifluoroacetic acid |
| SMILES | CC#CCn1c(=O)n(C)c2nc(Cl)nc(N3CCCC(N)C3)c21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H19ClN6O.C2HF3O2/c1-3-4-8-22-11-12(20(2)15(22)23)18-14(16)19-13(11)21-7-5-6-10(17)9-21;3-2(4,5)1(6)7/h10H,5-9,17H2,1-2H3;(H,6,7) |
| InChIKey | KWAOCVDPUQIWPG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 119.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.83 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|