C19H18ClF3N6O4 — CID 87588598
7-but-2-ynyl-2-chloro-9-(furan-3-yl)-6-piperazin-1-ylpurin-8-one;2,2,2-trifluoroacetic acid (PubChem CID 87588598) has the molecular formula C19H18ClF3N6O4 and a molecular weight of 486.84 g/mol. Its IUPAC name is 7-but-2-ynyl-2-chloro-9-(furan-3-yl)-6-piperazin-1-ylpurin-8-one;2,2,2-trifluoroacetic acid.
| Compound Name | 7-but-2-ynyl-2-chloro-9-(furan-3-yl)-6-piperazin-1-ylpurin-8-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87588598 |
| Molecular Formula | C19H18ClF3N6O4 |
| Molecular Weight | 486.84 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | 7-but-2-ynyl-2-chloro-9-(furan-3-yl)-6-piperazin-1-ylpurin-8-one;2,2,2-trifluoroacetic acid |
| SMILES | CC#CCn1c(=O)n(-c2ccoc2)c2nc(Cl)nc(N3CCNCC3)c21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H17ClN6O2.C2HF3O2/c1-2-3-7-23-13-14(22-8-5-19-6-9-22)20-16(18)21-15(13)24(17(23)25)12-4-10-26-11-12;3-2(4,5)1(6)7/h4,10-11,19H,5-9H2,1H3;(H,6,7) |
| InChIKey | ULDFBNMFIVTSFR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.84 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|