C21H18FNO5 — CID 9001509
[2-(1-methyl-2-oxo-3H-indol-5-yl)-2-oxoethyl] (E)-3-(3-fluoro-4-methoxyphenyl)prop-2-enoate (PubChem CID 9001509) has the molecular formula C21H18FNO5 and a molecular weight of 383.38 g/mol. Its IUPAC name is [2-(1-methyl-2-oxo-3H-indol-5-yl)-2-oxoethyl] (E)-3-(3-fluoro-4-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-(1-methyl-2-oxo-3H-indol-5-yl)-2-oxoethyl] (E)-3-(3-fluoro-4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 9001509 |
| Molecular Formula | C21H18FNO5 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | [2-(1-methyl-2-oxo-3H-indol-5-yl)-2-oxoethyl] (E)-3-(3-fluoro-4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OCC(=O)c2ccc3c(c2)CC(=O)N3C)cc1F |
| InChI | InChI=1S/C21H18FNO5/c1-23-17-6-5-14(10-15(17)11-20(23)25)18(24)12-28-21(26)8-4-13-3-7-19(27-2)16(22)9-13/h3-10H,11-12H2,1-2H3/b8-4+ |
| InChIKey | KFJRTDCNBGNKSX-XBXARRHUSA-N |
| XLogP | 2.79 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|