C21H26N4O — CID 90015475
6-(2-azabicyclo[3.1.0]hexan-2-yl)-N-(4-methyl-2-pyridinyl)-4-(oxan-4-yl)pyridin-2-amine (PubChem CID 90015475) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is 6-(2-azabicyclo[3.1.0]hexan-2-yl)-N-(4-methyl-2-pyridinyl)-4-(oxan-4-yl)pyridin-2-amine.
| Compound Name | 6-(2-azabicyclo[3.1.0]hexan-2-yl)-N-(4-methyl-2-pyridinyl)-4-(oxan-4-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 90015475 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 6-(2-azabicyclo[3.1.0]hexan-2-yl)-N-(4-methyl-2-pyridinyl)-4-(oxan-4-yl)pyridin-2-amine |
| SMILES | Cc1ccnc(Nc2cc(C3CCOCC3)cc(N3CCC4CC43)n2)c1 |
| InChI | InChI=1S/C21H26N4O/c1-14-2-6-22-19(10-14)23-20-12-17(15-4-8-26-9-5-15)13-21(24-20)25-7-3-16-11-18(16)25/h2,6,10,12-13,15-16,18H,3-5,7-9,11H2,1H3,(H,22,23,24) |
| InChIKey | WAQACELOLOFRCO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |