C18H22ClN3O — CID 134293567
6-chloro-4-(oxan-4-yl)-N-(4-propan-2-yl-2-pyridinyl)pyridin-2-amine (PubChem CID 134293567) has the molecular formula C18H22ClN3O and a molecular weight of 331.85 g/mol. Its IUPAC name is 6-chloro-4-(oxan-4-yl)-N-(4-propan-2-yl-2-pyridinyl)pyridin-2-amine.
| Compound Name | 6-chloro-4-(oxan-4-yl)-N-(4-propan-2-yl-2-pyridinyl)pyridin-2-amine |
|---|---|
| PubChem CID | 134293567 |
| Molecular Formula | C18H22ClN3O |
| Molecular Weight | 331.85 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 6-chloro-4-(oxan-4-yl)-N-(4-propan-2-yl-2-pyridinyl)pyridin-2-amine |
| SMILES | CC(C)c1ccnc(Nc2cc(C3CCOCC3)cc(Cl)n2)c1 |
| InChI | InChI=1S/C18H22ClN3O/c1-12(2)14-3-6-20-17(10-14)22-18-11-15(9-16(19)21-18)13-4-7-23-8-5-13/h3,6,9-13H,4-5,7-8H2,1-2H3,(H,20,21,22) |
| InChIKey | KPYXBKSCYVKIPZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.85 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|