C21H24F3N5O — CID 134293594
6-[(3Z)-3-(dimethylhydrazinylidene)prop-1-en-2-yl]-4-(oxan-4-yl)-N-[4-(trifluoromethyl)-2-pyridinyl]pyridin-2-amine (PubChem CID 134293594) has the molecular formula C21H24F3N5O and a molecular weight of 419.45 g/mol. Its IUPAC name is 6-[(3Z)-3-(dimethylhydrazinylidene)prop-1-en-2-yl]-4-(oxan-4-yl)-N-[4-(trifluoromethyl)-2-pyridinyl]pyridin-2-amine.
| Compound Name | 6-[(3Z)-3-(dimethylhydrazinylidene)prop-1-en-2-yl]-4-(oxan-4-yl)-N-[4-(trifluoromethyl)-2-pyridinyl]pyridin-2-amine |
|---|---|
| PubChem CID | 134293594 |
| Molecular Formula | C21H24F3N5O |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 6-[(3Z)-3-(dimethylhydrazinylidene)prop-1-en-2-yl]-4-(oxan-4-yl)-N-[4-(trifluoromethyl)-2-pyridinyl]pyridin-2-amine |
| SMILES | C=C(/C=N\N(C)C)c1cc(C2CCOCC2)cc(Nc2cc(C(F)(F)F)ccn2)n1 |
| InChI | InChI=1S/C21H24F3N5O/c1-14(13-26-29(2)3)18-10-16(15-5-8-30-9-6-15)11-20(27-18)28-19-12-17(4-7-25-19)21(22,23)24/h4,7,10-13,15H,1,5-6,8-9H2,2-3H3,(H,25,27,28)/b26-13- |
| InChIKey | AFWOPAQGCXSPEL-ZMFRSBBQSA-N |
| XLogP | 4.69 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|