C29H37F2N3O3 — CID 90018160
N-[2-fluoro-6-[4-[[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]methoxy]phenyl]benzoyl]piperidine-4-carboxamide (PubChem CID 90018160) has the molecular formula C29H37F2N3O3 and a molecular weight of 513.63 g/mol. Its IUPAC name is N-[2-fluoro-6-[4-[[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]methoxy]phenyl]benzoyl]piperidine-4-carboxamide.
| Compound Name | N-[2-fluoro-6-[4-[[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]methoxy]phenyl]benzoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 90018160 |
| Molecular Formula | C29H37F2N3O3 |
| Molecular Weight | 513.63 g/mol |
| Exact Mass | 513.28 |
| IUPAC Name | N-[2-fluoro-6-[4-[[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]methoxy]phenyl]benzoyl]piperidine-4-carboxamide |
| SMILES | CC(C)(F)CN1CCC(COc2ccc(-c3cccc(F)c3C(=O)NC(=O)C3CCNCC3)cc2)CC1 |
| InChI | InChI=1S/C29H37F2N3O3/c1-29(2,31)19-34-16-12-20(13-17-34)18-37-23-8-6-21(7-9-23)24-4-3-5-25(30)26(24)28(36)33-27(35)22-10-14-32-15-11-22/h3-9,20,22,32H,10-19H2,1-2H3,(H,33,35,36) |
| InChIKey | UTBBDQISTMHQNZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.63 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|