About dimethyl 2-fluoropent-2-enedioate;4-fluoro-5-methoxy-3-methyl-5-oxopent-3-enoic acid
dimethyl 2-fluoropent-2-enedioate;4-fluoro-5-methoxy-3-methyl-5-oxopent-3-enoic acid (PubChem CID 90024029) has the molecular formula C14H18F2O8
and a molecular weight of 352.29 g/mol. Its IUPAC name is dimethyl 2-fluoropent-2-enedioate;4-fluoro-5-methoxy-3-methyl-5-oxopent-3-enoic acid.
Molecular Properties
| Compound Name | dimethyl 2-fluoropent-2-enedioate;4-fluoro-5-methoxy-3-methyl-5-oxopent-3-enoic acid |
| PubChem CID | 90024029 |
| Molecular Formula | C14H18F2O8 |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | dimethyl 2-fluoropent-2-enedioate;4-fluoro-5-methoxy-3-methyl-5-oxopent-3-enoic acid |
| SMILES | COC(=O)C(F)=C(C)CC(=O)O.COC(=O)CC=C(F)C(=O)OC |
| InChI | InChI=1S/2C7H9FO4/c1-11-6(9)4-3-5(8)7(10)12-2;1-4(3-5(9)10)6(8)7(11)12-2/h3H,4H2,1-2H3;3H2,1-2H3,(H,9,10) |
| InChIKey | BSPDQTPVWVWQII-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-fluoropent-2-enedioate;4-fluoro-5-methoxy-3-methyl-5-oxopent-3-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-fluoropent-2-enedioate;4-fluoro-5-methoxy-3-methyl-5-oxopent-3-enoic acid?
The IUPAC name of dimethyl 2-fluoropent-2-enedioate;4-fluoro-5-methoxy-3-methyl-5-oxopent-3-enoic acid (CID 90024029) is dimethyl 2-fluoropent-2-enedioate;4-fluoro-5-methoxy-3-methyl-5-oxopent-3-enoic acid.
What is the SMILES notation for dimethyl 2-fluoropent-2-enedioate;4-fluoro-5-methoxy-3-methyl-5-oxopent-3-enoic acid?
The canonical SMILES for dimethyl 2-fluoropent-2-enedioate;4-fluoro-5-methoxy-3-methyl-5-oxopent-3-enoic acid is COC(=O)C(F)=C(C)CC(=O)O.COC(=O)CC=C(F)C(=O)OC.
What is the InChIKey of dimethyl 2-fluoropent-2-enedioate;4-fluoro-5-methoxy-3-methyl-5-oxopent-3-enoic acid?
The InChIKey is BSPDQTPVWVWQII-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H9FO4/c1-11-6(9)4-3-5(8)7(10)12-2;1-4(3-5(9)10)6(8)7(11)12-2/h3H,4H2,1-2H3;3H2,1-2H3,(H,9,10).
What are the key properties of dimethyl 2-fluoropent-2-enedioate;4-fluoro-5-methoxy-3-methyl-5-oxopent-3-enoic acid?
dimethyl 2-fluoropent-2-enedioate;4-fluoro-5-methoxy-3-methyl-5-oxopent-3-enoic acid has a molecular weight of 352.29 g/mol, XLogP of 1.45, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-fluoropent-2-enedioate;4-fluoro-5-methoxy-3-methyl-5-oxopent-3-enoic acid is sourced from PubChem (CID 90024029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).