C14H15BrN2O2 — CID 90025002
CID 90025002 (PubChem CID 90025002) has the molecular formula C14H15BrN2O2 and a molecular weight of 323.19 g/mol.
| Compound Name | CID 90025002 |
|---|---|
| PubChem CID | 90025002 |
| Molecular Formula | C14H15BrN2O2 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | — |
| SMILES | NC1=NC2(COC1)c1cc(Br)ccc1OCC21CC1 |
| InChI | InChI=1S/C14H15BrN2O2/c15-9-1-2-11-10(5-9)14(8-18-6-12(16)17-14)13(3-4-13)7-19-11/h1-2,5H,3-4,6-8H2,(H2,16,17) |
| InChIKey | VDIQADCRFALOMC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |