About US8975415, RP7b
US8975415, RP7b (PubChem CID 90056178) has the molecular formula C14H15BrN2O3
and a molecular weight of 339.19 g/mol.
Molecular Properties
| Compound Name | US8975415, RP7b |
| PubChem CID | 90056178 |
| Molecular Formula | C14H15BrN2O3 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | — |
| SMILES | C[C@@H]1Oc2ccc(Br)cc2[C@@]2(COC(N)=N2)C12COC2 |
| InChI | InChI=1S/C14H15BrN2O3/c1-8-13(5-18-6-13)14(7-19-12(16)17-14)10-4-9(15)2-3-11(10)20-8/h2-4,8H,5-7H2,1H3,(H2,16,17)/t8-,14-/m0/s1 |
| InChIKey | UGDRTDNGDMXMII-RTHLEPHNSA-N |
| XLogP | 1.79 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze US8975415, RP7b with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US8975415, RP7b?
The IUPAC name of US8975415, RP7b (CID 90056178) is not available.
What is the SMILES notation for US8975415, RP7b?
The canonical SMILES for US8975415, RP7b is C[C@@H]1Oc2ccc(Br)cc2[C@@]2(COC(N)=N2)C12COC2.
What is the InChIKey of US8975415, RP7b?
The InChIKey is UGDRTDNGDMXMII-RTHLEPHNSA-N. The full InChI is InChI=1S/C14H15BrN2O3/c1-8-13(5-18-6-13)14(7-19-12(16)17-14)10-4-9(15)2-3-11(10)20-8/h2-4,8H,5-7H2,1H3,(H2,16,17)/t8-,14-/m0/s1.
What are the key properties of US8975415, RP7b?
US8975415, RP7b has a molecular weight of 339.19 g/mol, XLogP of 1.79, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for US8975415, RP7b is sourced from PubChem (CID 90056178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).