C14H15BrN2O3 — CID 90056182
US8975415, RP7a (PubChem CID 90056182) has the molecular formula C14H15BrN2O3 and a molecular weight of 339.19 g/mol.
| Compound Name | US8975415, RP7a |
|---|---|
| PubChem CID | 90056182 |
| Molecular Formula | C14H15BrN2O3 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | — |
| SMILES | C[C@H]1Oc2ccc(Br)cc2[C@@]2(COC(N)=N2)C12COC2 |
| InChI | InChI=1S/C14H15BrN2O3/c1-8-13(5-18-6-13)14(7-19-12(16)17-14)10-4-9(15)2-3-11(10)20-8/h2-4,8H,5-7H2,1H3,(H2,16,17)/t8-,14+/m1/s1 |
| InChIKey | UGDRTDNGDMXMII-CLAHSXSESA-N |
| XLogP | 1.79 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |