C24H24O4 — CID 90026257
2-[4-[(2R,3R)-2-hydroxy-3-phenyl-3-phenylmethoxypropoxy]phenyl]acetaldehyde (PubChem CID 90026257) has the molecular formula C24H24O4 and a molecular weight of 376.45 g/mol. Its IUPAC name is 2-[4-[(2R,3R)-2-hydroxy-3-phenyl-3-phenylmethoxypropoxy]phenyl]acetaldehyde.
| Compound Name | 2-[4-[(2R,3R)-2-hydroxy-3-phenyl-3-phenylmethoxypropoxy]phenyl]acetaldehyde |
|---|---|
| PubChem CID | 90026257 |
| Molecular Formula | C24H24O4 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 2-[4-[(2R,3R)-2-hydroxy-3-phenyl-3-phenylmethoxypropoxy]phenyl]acetaldehyde |
| SMILES | O=CCc1ccc(OC[C@@H](O)[C@H](OCc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H24O4/c25-16-15-19-11-13-22(14-12-19)27-18-23(26)24(21-9-5-2-6-10-21)28-17-20-7-3-1-4-8-20/h1-14,16,23-24,26H,15,17-18H2/t23-,24-/m1/s1 |
| InChIKey | OKMMRWLNZNTVQA-DNQXCXABSA-N |
| XLogP | 4.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|