C24H21F4N3O2 — CID 90028863
N-[4-amino-3-(2-fluorophenyl)-4-imino-2-[2-(trifluoromethyl)phenyl]butyl]-2-hydroxybenzamide (PubChem CID 90028863) has the molecular formula C24H21F4N3O2 and a molecular weight of 459.44 g/mol. Its IUPAC name is N-[4-amino-3-(2-fluorophenyl)-4-imino-2-[2-(trifluoromethyl)phenyl]butyl]-2-hydroxybenzamide.
| Compound Name | N-[4-amino-3-(2-fluorophenyl)-4-imino-2-[2-(trifluoromethyl)phenyl]butyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 90028863 |
| Molecular Formula | C24H21F4N3O2 |
| Molecular Weight | 459.44 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | N-[4-amino-3-(2-fluorophenyl)-4-imino-2-[2-(trifluoromethyl)phenyl]butyl]-2-hydroxybenzamide |
| SMILES | [H]/N=C(\N)C(c1ccccc1F)C(CNC(=O)c1ccccc1O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C24H21F4N3O2/c25-19-11-5-2-8-15(19)21(22(29)30)17(14-7-1-4-10-18(14)24(26,27)28)13-31-23(33)16-9-3-6-12-20(16)32/h1-12,17,21,32H,13H2,(H3,29,30)(H,31,33) |
| InChIKey | XJSRJJRYFNVXNJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 99.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|