C27H24ClN3O2 — CID 90028342
N-[4-amino-3-(4-chlorophenyl)-4-imino-2-naphthalen-1-ylbutyl]-2-hydroxybenzamide (PubChem CID 90028342) has the molecular formula C27H24ClN3O2 and a molecular weight of 457.96 g/mol. Its IUPAC name is N-[4-amino-3-(4-chlorophenyl)-4-imino-2-naphthalen-1-ylbutyl]-2-hydroxybenzamide.
| Compound Name | N-[4-amino-3-(4-chlorophenyl)-4-imino-2-naphthalen-1-ylbutyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 90028342 |
| Molecular Formula | C27H24ClN3O2 |
| Molecular Weight | 457.96 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | N-[4-amino-3-(4-chlorophenyl)-4-imino-2-naphthalen-1-ylbutyl]-2-hydroxybenzamide |
| SMILES | [H]/N=C(\N)C(c1ccc(Cl)cc1)C(CNC(=O)c1ccccc1O)c1cccc2ccccc12 |
| InChI | InChI=1S/C27H24ClN3O2/c28-19-14-12-18(13-15-19)25(26(29)30)23(16-31-27(33)22-9-3-4-11-24(22)32)21-10-5-7-17-6-1-2-8-20(17)21/h1-15,23,25,32H,16H2,(H3,29,30)(H,31,33) |
| InChIKey | QHHJLHQCXMSSPM-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 99.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.96 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|