C17H8ClF3N6 — CID 90034315
1-[2-chloro-5-(trifluoromethyl)phenyl]-4-(7H-purin-6-yl)pyrrole-2-carbonitrile (PubChem CID 90034315) has the molecular formula C17H8ClF3N6 and a molecular weight of 388.74 g/mol. Its IUPAC name is 1-[2-chloro-5-(trifluoromethyl)phenyl]-4-(7H-purin-6-yl)pyrrole-2-carbonitrile.
| Compound Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-4-(7H-purin-6-yl)pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 90034315 |
| Molecular Formula | C17H8ClF3N6 |
| Molecular Weight | 388.74 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-4-(7H-purin-6-yl)pyrrole-2-carbonitrile |
| SMILES | N#Cc1cc(-c2ncnc3nc[nH]c23)cn1-c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C17H8ClF3N6/c18-12-2-1-10(17(19,20)21)4-13(12)27-6-9(3-11(27)5-22)14-15-16(25-7-23-14)26-8-24-15/h1-4,6-8H,(H,23,24,25,26) |
| InChIKey | ASRHEFMFBLHXTI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 83.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.74 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |