C12H17F3O — CID 90036245
1,5,6-trifluoro-6-hexoxycyclohexa-1,3-diene (PubChem CID 90036245) has the molecular formula C12H17F3O and a molecular weight of 234.26 g/mol. Its IUPAC name is 1,5,6-trifluoro-6-hexoxycyclohexa-1,3-diene.
| Compound Name | 1,5,6-trifluoro-6-hexoxycyclohexa-1,3-diene |
|---|---|
| PubChem CID | 90036245 |
| Molecular Formula | C12H17F3O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 1,5,6-trifluoro-6-hexoxycyclohexa-1,3-diene |
| SMILES | CCCCCCOC1(F)C(F)=CC=CC1F |
| InChI | InChI=1S/C12H17F3O/c1-2-3-4-5-9-16-12(15)10(13)7-6-8-11(12)14/h6-8,10H,2-5,9H2,1H3 |
| InChIKey | WGJKLAOWBKKFPI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|