C21H20FNO5 — CID 9004128
[2-(4-fluorophenyl)-2-oxoethyl] (3R)-1-(2-ethoxyphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 9004128) has the molecular formula C21H20FNO5 and a molecular weight of 385.39 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] (3R)-1-(2-ethoxyphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] (3R)-1-(2-ethoxyphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 9004128 |
| Molecular Formula | C21H20FNO5 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] (3R)-1-(2-ethoxyphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCOc1ccccc1N1C[C@H](C(=O)OCC(=O)c2ccc(F)cc2)CC1=O |
| InChI | InChI=1S/C21H20FNO5/c1-2-27-19-6-4-3-5-17(19)23-12-15(11-20(23)25)21(26)28-13-18(24)14-7-9-16(22)10-8-14/h3-10,15H,2,11-13H2,1H3/t15-/m1/s1 |
| InChIKey | HJCACNVIAAWIMR-OAHLLOKOSA-N |
| XLogP | 3.00 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |