C24H28N4O2 — CID 90041934
N-cyclopropyl-5-[2-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-1-hydroxyethyl]pyridine-2-carboxamide (PubChem CID 90041934) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is N-cyclopropyl-5-[2-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-1-hydroxyethyl]pyridine-2-carboxamide.
| Compound Name | N-cyclopropyl-5-[2-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-1-hydroxyethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 90041934 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | N-cyclopropyl-5-[2-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-1-hydroxyethyl]pyridine-2-carboxamide |
| SMILES | Cc1ccc2c(c1)c1c(n2CC(O)c2ccc(C(=O)NC3CC3)nc2)CCN(C)C1 |
| InChI | InChI=1S/C24H28N4O2/c1-15-3-8-21-18(11-15)19-13-27(2)10-9-22(19)28(21)14-23(29)16-4-7-20(25-12-16)24(30)26-17-5-6-17/h3-4,7-8,11-12,17,23,29H,5-6,9-10,13-14H2,1-2H3,(H,26,30) |
| InChIKey | XSXVNGYWYUYQIQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|