C11H11ClIN3O4 — CID 90043050
(2R,3R,4R)-4-[(6-chloro-5-iodo-1H-imidazo[4,5-b]pyridin-2-yl)oxy]-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 90043050) has the molecular formula C11H11ClIN3O4 and a molecular weight of 411.58 g/mol. Its IUPAC name is (2R,3R,4R)-4-[(6-chloro-5-iodo-1H-imidazo[4,5-b]pyridin-2-yl)oxy]-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,4R)-4-[(6-chloro-5-iodo-1H-imidazo[4,5-b]pyridin-2-yl)oxy]-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 90043050 |
| Molecular Formula | C11H11ClIN3O4 |
| Molecular Weight | 411.58 g/mol |
| Exact Mass | 410.95 |
| IUPAC Name | (2R,3R,4R)-4-[(6-chloro-5-iodo-1H-imidazo[4,5-b]pyridin-2-yl)oxy]-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | OC[C@H]1OC[C@@H](Oc2nc3nc(I)c(Cl)cc3[nH]2)[C@@H]1O |
| InChI | InChI=1S/C11H11ClIN3O4/c12-4-1-5-10(15-9(4)13)16-11(14-5)20-7-3-19-6(2-17)8(7)18/h1,6-8,17-18H,2-3H2,(H,14,15,16)/t6-,7-,8-/m1/s1 |
| InChIKey | GTNUAEAATNQDHR-BWZBUEFSSA-N |
| XLogP | 0.72 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.58 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|