C36H30N4 — CID 90055180
5-(4,6-diphenyl-1,3,5-triazin-2-yl)-7,7-dimethyl-8,9,10,11-tetrahydroindeno[2,1-b]carbazole (PubChem CID 90055180) has the molecular formula C36H30N4 and a molecular weight of 518.66 g/mol. Its IUPAC name is 5-(4,6-diphenyl-1,3,5-triazin-2-yl)-7,7-dimethyl-8,9,10,11-tetrahydroindeno[2,1-b]carbazole.
| Compound Name | 5-(4,6-diphenyl-1,3,5-triazin-2-yl)-7,7-dimethyl-8,9,10,11-tetrahydroindeno[2,1-b]carbazole |
|---|---|
| PubChem CID | 90055180 |
| Molecular Formula | C36H30N4 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | 5-(4,6-diphenyl-1,3,5-triazin-2-yl)-7,7-dimethyl-8,9,10,11-tetrahydroindeno[2,1-b]carbazole |
| SMILES | CC1(C)C2=C(CCCC2)c2cc3c4ccccc4n(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3cc21 |
| InChI | InChI=1S/C36H30N4/c1-36(2)29-19-11-9-17-25(29)27-21-28-26-18-10-12-20-31(26)40(32(28)22-30(27)36)35-38-33(23-13-5-3-6-14-23)37-34(39-35)24-15-7-4-8-16-24/h3-8,10,12-16,18,20-22H,9,11,17,19H2,1-2H3 |
| InChIKey | URYLBKCFEUNHOS-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |