C77H68N2O8S4 — CID 90058084
2-N,2-N,7-N,7-N-tetrakis[4-(3,4-dimethoxy-5-methylthiophen-2-yl)phenyl]-9,9-diphenylfluorene-2,7-diamine (PubChem CID 90058084) has the molecular formula C77H68N2O8S4 and a molecular weight of 1277.66 g/mol. Its IUPAC name is 2-N,2-N,7-N,7-N-tetrakis[4-(3,4-dimethoxy-5-methylthiophen-2-yl)phenyl]-9,9-diphenylfluorene-2,7-diamine.
| Compound Name | 2-N,2-N,7-N,7-N-tetrakis[4-(3,4-dimethoxy-5-methylthiophen-2-yl)phenyl]-9,9-diphenylfluorene-2,7-diamine |
|---|---|
| PubChem CID | 90058084 |
| Molecular Formula | C77H68N2O8S4 |
| Molecular Weight | 1277.66 g/mol |
| Exact Mass | 1276.39 |
| IUPAC Name | 2-N,2-N,7-N,7-N-tetrakis[4-(3,4-dimethoxy-5-methylthiophen-2-yl)phenyl]-9,9-diphenylfluorene-2,7-diamine |
| SMILES | COc1c(C)sc(-c2ccc(N(c3ccc(-c4sc(C)c(OC)c4OC)cc3)c3ccc4c(c3)C(c3ccccc3)(c3ccccc3)c3cc(N(c5ccc(-c6sc(C)c(OC)c6OC)cc5)c5ccc(-c6sc(C)c(OC)c6OC)cc5)ccc3-4)cc2)c1OC |
| InChI | InChI=1S/C77H68N2O8S4/c1-45-65(80-5)69(84-9)73(88-45)49-23-31-55(32-24-49)78(56-33-25-50(26-34-56)74-70(85-10)66(81-6)46(2)89-74)59-39-41-61-62-42-40-60(44-64(62)77(63(61)43-59,53-19-15-13-16-20-53)54-21-17-14-18-22-54)79(57-35-27-51(28-36-57)75-71(86-11)67(82-7)47(3)90-75)58-37-29-52(30-38-58)76-72(87-12)68(83-8)48(4)91-76/h13-44H,1-12H3 |
| InChIKey | MXWSKHBTMDDWHT-UHFFFAOYSA-N |
| XLogP | 21.21 |
| TPSA | 80.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 91 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1277.66 |
| LogP ≤ 5 | 21.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |