C55H52N2O4S2 — CID 90059139
2-[[2-[7-[5-[(1,3-dioxoinden-2-ylidene)methyl]-1,3-thiazol-2-yl]-9,9-dioctylfluoren-2-yl]-1,3-thiazol-5-yl]methylidene]indene-1,3-dione (PubChem CID 90059139) has the molecular formula C55H52N2O4S2 and a molecular weight of 869.16 g/mol. Its IUPAC name is 2-[[2-[7-[5-[(1,3-dioxoinden-2-ylidene)methyl]-1,3-thiazol-2-yl]-9,9-dioctylfluoren-2-yl]-1,3-thiazol-5-yl]methylidene]indene-1,3-dione.
| Compound Name | 2-[[2-[7-[5-[(1,3-dioxoinden-2-ylidene)methyl]-1,3-thiazol-2-yl]-9,9-dioctylfluoren-2-yl]-1,3-thiazol-5-yl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 90059139 |
| Molecular Formula | C55H52N2O4S2 |
| Molecular Weight | 869.16 g/mol |
| Exact Mass | 868.34 |
| IUPAC Name | 2-[[2-[7-[5-[(1,3-dioxoinden-2-ylidene)methyl]-1,3-thiazol-2-yl]-9,9-dioctylfluoren-2-yl]-1,3-thiazol-5-yl]methylidene]indene-1,3-dione |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(-c3ncc(C=C4C(=O)c5ccccc5C4=O)s3)ccc2-c2ccc(-c3ncc(C=C4C(=O)c5ccccc5C4=O)s3)cc21 |
| InChI | InChI=1S/C55H52N2O4S2/c1-3-5-7-9-11-17-27-55(28-18-12-10-8-6-4-2)47-29-35(53-56-33-37(62-53)31-45-49(58)41-19-13-14-20-42(41)50(45)59)23-25-39(47)40-26-24-36(30-48(40)55)54-57-34-38(63-54)32-46-51(60)43-21-15-16-22-44(43)52(46)61/h13-16,19-26,29-34H,3-12,17-18,27-28H2,1-2H3 |
| InChIKey | IBONVYYEFCTQSU-UHFFFAOYSA-N |
| XLogP | 14.63 |
| TPSA | 94.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.16 |
| LogP ≤ 5 | 14.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|