C51H44N2O4S2 — CID 90059180
2-[[2-[7-[5-[(1,3-dioxoinden-2-ylidene)methyl]-1,3-thiazol-2-yl]-9,9-dihexylfluoren-2-yl]-1,3-thiazol-5-yl]methylidene]indene-1,3-dione (PubChem CID 90059180) has the molecular formula C51H44N2O4S2 and a molecular weight of 813.06 g/mol. Its IUPAC name is 2-[[2-[7-[5-[(1,3-dioxoinden-2-ylidene)methyl]-1,3-thiazol-2-yl]-9,9-dihexylfluoren-2-yl]-1,3-thiazol-5-yl]methylidene]indene-1,3-dione.
| Compound Name | 2-[[2-[7-[5-[(1,3-dioxoinden-2-ylidene)methyl]-1,3-thiazol-2-yl]-9,9-dihexylfluoren-2-yl]-1,3-thiazol-5-yl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 90059180 |
| Molecular Formula | C51H44N2O4S2 |
| Molecular Weight | 813.06 g/mol |
| Exact Mass | 812.27 |
| IUPAC Name | 2-[[2-[7-[5-[(1,3-dioxoinden-2-ylidene)methyl]-1,3-thiazol-2-yl]-9,9-dihexylfluoren-2-yl]-1,3-thiazol-5-yl]methylidene]indene-1,3-dione |
| SMILES | CCCCCCC1(CCCCCC)c2cc(-c3ncc(C=C4C(=O)c5ccccc5C4=O)s3)ccc2-c2ccc(-c3ncc(C=C4C(=O)c5ccccc5C4=O)s3)cc21 |
| InChI | InChI=1S/C51H44N2O4S2/c1-3-5-7-13-23-51(24-14-8-6-4-2)43-25-31(49-52-29-33(58-49)27-41-45(54)37-15-9-10-16-38(37)46(41)55)19-21-35(43)36-22-20-32(26-44(36)51)50-53-30-34(59-50)28-42-47(56)39-17-11-12-18-40(39)48(42)57/h9-12,15-22,25-30H,3-8,13-14,23-24H2,1-2H3 |
| InChIKey | WVMQVKKLTFFVJR-UHFFFAOYSA-N |
| XLogP | 13.07 |
| TPSA | 94.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.06 |
| LogP ≤ 5 | 13.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|