C5H10N4OS — CID 90063757
3-[amino(propan-2-yl)amino]-2H-1,2,4-oxadiazole-5-thione (PubChem CID 90063757) has the molecular formula C5H10N4OS and a molecular weight of 174.23 g/mol. Its IUPAC name is 3-[amino(propan-2-yl)amino]-2H-1,2,4-oxadiazole-5-thione.
| Compound Name | 3-[amino(propan-2-yl)amino]-2H-1,2,4-oxadiazole-5-thione |
|---|---|
| PubChem CID | 90063757 |
| Molecular Formula | C5H10N4OS |
| Molecular Weight | 174.23 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | 3-[amino(propan-2-yl)amino]-2H-1,2,4-oxadiazole-5-thione |
| SMILES | CC(C)N(N)c1nc(=S)o[nH]1 |
| InChI | InChI=1S/C5H10N4OS/c1-3(2)9(6)4-7-5(11)10-8-4/h3H,6H2,1-2H3,(H,7,8,11) |
| InChIKey | PYQRRHBULDQRPV-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.23 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|