C17H27BN2O5S — CID 90064794
N-[2-morpholin-4-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide (PubChem CID 90064794) has the molecular formula C17H27BN2O5S and a molecular weight of 382.29 g/mol. Its IUPAC name is N-[2-morpholin-4-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide.
| Compound Name | N-[2-morpholin-4-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 90064794 |
| Molecular Formula | C17H27BN2O5S |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | N-[2-morpholin-4-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide |
| SMILES | CC1(C)OB(c2ccc(N3CCOCC3)c(NS(C)(=O)=O)c2)OC1(C)C |
| InChI | InChI=1S/C17H27BN2O5S/c1-16(2)17(3,4)25-18(24-16)13-6-7-15(20-8-10-23-11-9-20)14(12-13)19-26(5,21)22/h6-7,12,19H,8-11H2,1-5H3 |
| InChIKey | HAQPZLVGJXXCIL-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|