C26H29N3O2 — CID 9006804
(2R)-3-benzyl-2-[4-[ethyl(2-hydroxyethyl)amino]-2-methylphenyl]-1,2-dihydroquinazolin-4-one (PubChem CID 9006804) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is (2R)-3-benzyl-2-[4-[ethyl(2-hydroxyethyl)amino]-2-methylphenyl]-1,2-dihydroquinazolin-4-one.
| Compound Name | (2R)-3-benzyl-2-[4-[ethyl(2-hydroxyethyl)amino]-2-methylphenyl]-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 9006804 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | (2R)-3-benzyl-2-[4-[ethyl(2-hydroxyethyl)amino]-2-methylphenyl]-1,2-dihydroquinazolin-4-one |
| SMILES | CCN(CCO)c1ccc([C@@H]2Nc3ccccc3C(=O)N2Cc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C26H29N3O2/c1-3-28(15-16-30)21-13-14-22(19(2)17-21)25-27-24-12-8-7-11-23(24)26(31)29(25)18-20-9-5-4-6-10-20/h4-14,17,25,27,30H,3,15-16,18H2,1-2H3/t25-/m1/s1 |
| InChIKey | CADRFCVSCNJDCS-RUZDIDTESA-N |
| XLogP | 4.58 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|