C30H38IN5O4 — CID 90070744
tert-butyl 4-[cyclopropyl-[2-[4-[2-[(2S)-2-iodopyrrolidin-1-yl]-2-oxoethyl]phenyl]pyrimidine-5-carbonyl]amino]piperidine-1-carboxylate (PubChem CID 90070744) has the molecular formula C30H38IN5O4 and a molecular weight of 659.57 g/mol. Its IUPAC name is tert-butyl 4-[cyclopropyl-[2-[4-[2-[(2S)-2-iodopyrrolidin-1-yl]-2-oxoethyl]phenyl]pyrimidine-5-carbonyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[cyclopropyl-[2-[4-[2-[(2S)-2-iodopyrrolidin-1-yl]-2-oxoethyl]phenyl]pyrimidine-5-carbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 90070744 |
| Molecular Formula | C30H38IN5O4 |
| Molecular Weight | 659.57 g/mol |
| Exact Mass | 659.20 |
| IUPAC Name | tert-butyl 4-[cyclopropyl-[2-[4-[2-[(2S)-2-iodopyrrolidin-1-yl]-2-oxoethyl]phenyl]pyrimidine-5-carbonyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N(C(=O)c2cnc(-c3ccc(CC(=O)N4CCC[C@@H]4I)cc3)nc2)C2CC2)CC1 |
| InChI | InChI=1S/C30H38IN5O4/c1-30(2,3)40-29(39)34-15-12-24(13-16-34)36(23-10-11-23)28(38)22-18-32-27(33-19-22)21-8-6-20(7-9-21)17-26(37)35-14-4-5-25(35)31/h6-9,18-19,23-25H,4-5,10-17H2,1-3H3/t25-/m1/s1 |
| InChIKey | IKRIEFSIEYXCSM-RUZDIDTESA-N |
| XLogP | 5.07 |
| TPSA | 95.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.57 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|