C15H23F3O4 — CID 90080021
(2R,4R)-5-cyclopropyl-4-[(2-methylpropan-2-yl)oxy]-3-oxo-2-(3,3,3-trifluoropropyl)pentanoic acid (PubChem CID 90080021) has the molecular formula C15H23F3O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is (2R,4R)-5-cyclopropyl-4-[(2-methylpropan-2-yl)oxy]-3-oxo-2-(3,3,3-trifluoropropyl)pentanoic acid.
| Compound Name | (2R,4R)-5-cyclopropyl-4-[(2-methylpropan-2-yl)oxy]-3-oxo-2-(3,3,3-trifluoropropyl)pentanoic acid |
|---|---|
| PubChem CID | 90080021 |
| Molecular Formula | C15H23F3O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (2R,4R)-5-cyclopropyl-4-[(2-methylpropan-2-yl)oxy]-3-oxo-2-(3,3,3-trifluoropropyl)pentanoic acid |
| SMILES | CC(C)(C)O[C@H](CC1CC1)C(=O)[C@@H](CCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C15H23F3O4/c1-14(2,3)22-11(8-9-4-5-9)12(19)10(13(20)21)6-7-15(16,17)18/h9-11H,4-8H2,1-3H3,(H,20,21)/t10-,11-/m1/s1 |
| InChIKey | MMVRHTJAWZRVQN-GHMZBOCLSA-N |
| XLogP | 3.58 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|