C11H17F3O4 — CID 171833577
(2E)-5,5,5-trifluoro-2-[2-hydroxy-2-[(2-methylpropan-2-yl)oxy]ethylidene]pentanoic acid (PubChem CID 171833577) has the molecular formula C11H17F3O4 and a molecular weight of 270.25 g/mol. Its IUPAC name is (2E)-5,5,5-trifluoro-2-[2-hydroxy-2-[(2-methylpropan-2-yl)oxy]ethylidene]pentanoic acid.
| Compound Name | (2E)-5,5,5-trifluoro-2-[2-hydroxy-2-[(2-methylpropan-2-yl)oxy]ethylidene]pentanoic acid |
|---|---|
| PubChem CID | 171833577 |
| Molecular Formula | C11H17F3O4 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | (2E)-5,5,5-trifluoro-2-[2-hydroxy-2-[(2-methylpropan-2-yl)oxy]ethylidene]pentanoic acid |
| SMILES | CC(C)(C)OC(O)/C=C(\CCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C11H17F3O4/c1-10(2,3)18-8(15)6-7(9(16)17)4-5-11(12,13)14/h6,8,15H,4-5H2,1-3H3,(H,16,17)/b7-6+ |
| InChIKey | VMRWMBYVVZBGNC-VOTSOKGWSA-N |
| XLogP | 2.47 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|